C26H46N3O10+ — CID 142755356
(2R,3R,4R,5S)-6-[3-(1,3-diethylbenzimidazol-1-ium-5-yl)propyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 142755356) has the molecular formula C26H46N3O10+ and a molecular weight of 560.67 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-(1,3-diethylbenzimidazol-1-ium-5-yl)propyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[3-(1,3-diethylbenzimidazol-1-ium-5-yl)propyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 142755356 |
| Molecular Formula | C26H46N3O10+ |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-(1,3-diethylbenzimidazol-1-ium-5-yl)propyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCn1c[n+](CC)c2ccc(CCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc21 |
| InChI | InChI=1S/C26H46N3O10/c1-3-28-15-29(4-2)18-10-16(7-8-17(18)28)6-5-9-27(11-19(32)23(36)25(38)21(34)13-30)12-20(33)24(37)26(39)22(35)14-31/h7-8,10,15,19-26,30-39H,3-6,9,11-14H2,1-2H3/q+1/t19-,20-,21+,22+,23+,24+,25+,26+/m0/s1 |
| InChIKey | OHPXGNROEMMWAF-LPKNJJOBSA-N |
| XLogP | -3.92 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|