C25H44N3O11+ — CID 142755376
(2R,3R,4R,5S)-6-[2-(1,3-diethylbenzimidazol-1-ium-5-yl)oxyethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 142755376) has the molecular formula C25H44N3O11+ and a molecular weight of 562.64 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[2-(1,3-diethylbenzimidazol-1-ium-5-yl)oxyethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-[2-(1,3-diethylbenzimidazol-1-ium-5-yl)oxyethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 142755376 |
| Molecular Formula | C25H44N3O11+ |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | (2R,3R,4R,5S)-6-[2-(1,3-diethylbenzimidazol-1-ium-5-yl)oxyethyl-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | CCn1c[n+](CC)c2ccc(OCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc21 |
| InChI | InChI=1S/C25H44N3O11/c1-3-27-14-28(4-2)17-9-15(5-6-16(17)27)39-8-7-26(10-18(31)22(35)24(37)20(33)12-29)11-19(32)23(36)25(38)21(34)13-30/h5-6,9,14,18-25,29-38H,3-4,7-8,10-13H2,1-2H3/q+1/t18-,19-,20+,21+,22+,23+,24+,25+/m0/s1 |
| InChIKey | SEPZCBVRUZIPCZ-XZIFBPPASA-N |
| XLogP | -4.48 |
| TPSA | 223.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|