C8H13N3O3 — CID 142755640
5-(3-aminopropoxymethyl)-1H-pyrimidine-2,4-dione (PubChem CID 142755640) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(3-aminopropoxymethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(3-aminopropoxymethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142755640 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-(3-aminopropoxymethyl)-1H-pyrimidine-2,4-dione |
| SMILES | NCCCOCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O3/c9-2-1-3-14-5-6-4-10-8(13)11-7(6)12/h4H,1-3,5,9H2,(H2,10,11,12,13) |
| InChIKey | SAROYIPFGXNWEO-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|