C20H26N2O4 — CID 142757396
6-[3-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxylic acid (PubChem CID 142757396) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 6-[3-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxylic acid.
| Compound Name | 6-[3-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxylic acid |
|---|---|
| PubChem CID | 142757396 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 6-[3-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-5-azaspiro[2.5]octane-7-carboxylic acid |
| SMILES | COc1ccc(C2CCN(C(=O)C3NCC4(CC4)CC3C(=O)O)C2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-26-15-4-2-13(3-5-15)14-6-9-22(11-14)18(23)17-16(19(24)25)10-20(7-8-20)12-21-17/h2-5,14,16-17,21H,6-12H2,1H3,(H,24,25) |
| InChIKey | GKLVCSCAPJQSFN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |