C9H18ClN3O3 — CID 142757732
[2-(methylamino)-2-oxoethyl]-piperidin-4-ylcarbamic acid;hydrochloride (PubChem CID 142757732) has the molecular formula C9H18ClN3O3 and a molecular weight of 251.71 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl]-piperidin-4-ylcarbamic acid;hydrochloride.
| Compound Name | [2-(methylamino)-2-oxoethyl]-piperidin-4-ylcarbamic acid;hydrochloride |
|---|---|
| PubChem CID | 142757732 |
| Molecular Formula | C9H18ClN3O3 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl]-piperidin-4-ylcarbamic acid;hydrochloride |
| SMILES | CNC(=O)CN(C(=O)O)C1CCNCC1.Cl |
| InChI | InChI=1S/C9H17N3O3.ClH/c1-10-8(13)6-12(9(14)15)7-2-4-11-5-3-7;/h7,11H,2-6H2,1H3,(H,10,13)(H,14,15);1H |
| InChIKey | BLTSURSMWFRBFV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |