About ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate
ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate (PubChem CID 142758222) has the molecular formula C33H40FNO4
and a molecular weight of 533.68 g/mol. Its IUPAC name is ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate.
Molecular Properties
| Compound Name | ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate |
| PubChem CID | 142758222 |
| Molecular Formula | C33H40FNO4 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)C(CF)C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H40FNO4/c1-31(2,3)38-29(36)24(23-34)22-28(30(37)39-32(4,5)6)35-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,24,28,35H,22-23H2,1-6H3/t24?,28-/m0/s1 |
| InChIKey | QXGGCIRAANZMIK-AZKKKJBWSA-N |
| XLogP | 6.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate?
The IUPAC name of ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate (CID 142758222) is ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate.
What is the SMILES notation for ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate?
The canonical SMILES for ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate is CC(C)(C)OC(=O)C(CF)C[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate?
The InChIKey is QXGGCIRAANZMIK-AZKKKJBWSA-N. The full InChI is InChI=1S/C33H40FNO4/c1-31(2,3)38-29(36)24(23-34)22-28(30(37)39-32(4,5)6)35-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,24,28,35H,22-23H2,1-6H3/t24?,28-/m0/s1.
What are the key properties of ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate?
ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate has a molecular weight of 533.68 g/mol, XLogP of 6.60, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (4S)-2-(fluoromethyl)-4-(tritylamino)pentanedioate is sourced from PubChem (CID 142758222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).