About 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 142758610) has the molecular formula C15H13NO2S2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 142758610 |
| Molecular Formula | C15H13NO2S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cc1cc(C)cc(Sc2c(C(=O)O)[nH]c3ccsc23)c1 |
| InChI | InChI=1S/C15H13NO2S2/c1-8-5-9(2)7-10(6-8)20-14-12(15(17)18)16-11-3-4-19-13(11)14/h3-7,16H,1-2H3,(H,17,18) |
| InChIKey | ZJVQCRZOBOSLDE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 142758610) is 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is Cc1cc(C)cc(Sc2c(C(=O)O)[nH]c3ccsc23)c1.
What is the InChIKey of 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is ZJVQCRZOBOSLDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S2/c1-8-5-9(2)7-10(6-8)20-14-12(15(17)18)16-11-3-4-19-13(11)14/h3-7,16H,1-2H3,(H,17,18).
What are the key properties of 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 303.41 g/mol, XLogP of 4.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylphenyl)sulfanyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 142758610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).