C18H18N2O5 — CID 142759667
N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-hydroxybenzamide;hydrate (PubChem CID 142759667) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-hydroxybenzamide;hydrate.
| Compound Name | N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-hydroxybenzamide;hydrate |
|---|---|
| PubChem CID | 142759667 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-hydroxybenzamide;hydrate |
| SMILES | O.O=C(NN1C(=O)C2C3C=CC(C4CC34)C2C1=O)c1ccccc1O |
| InChI | InChI=1S/C18H16N2O4.H2O/c21-13-4-2-1-3-10(13)16(22)19-20-17(23)14-8-5-6-9(12-7-11(8)12)15(14)18(20)24;/h1-6,8-9,11-12,14-15,21H,7H2,(H,19,22);1H2 |
| InChIKey | QJGJJLNTVIVLCA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|