C26H32N2O3 — CID 1427599
N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-(furan-2-yl)-3-(2-methoxyphenyl)propyl]propanamide (PubChem CID 1427599) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-(furan-2-yl)-3-(2-methoxyphenyl)propyl]propanamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-(furan-2-yl)-3-(2-methoxyphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 1427599 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-(furan-2-yl)-3-(2-methoxyphenyl)propyl]propanamide |
| SMILES | CCC(=O)N(CC[C@H](c1ccco1)c1ccccc1OC)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-5-26(29)28(19-20-12-14-21(15-13-20)27(2)3)17-16-23(25-11-8-18-31-25)22-9-6-7-10-24(22)30-4/h6-15,18,23H,5,16-17,19H2,1-4H3/t23-/m0/s1 |
| InChIKey | STFAFNSTEPHHIS-QHCPKHFHSA-N |
| XLogP | 5.32 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|