About (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine
(E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine (PubChem CID 142761663) has the molecular formula C21H25N
and a molecular weight of 291.44 g/mol. Its IUPAC name is (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine.
Molecular Properties
| Compound Name | (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine |
| PubChem CID | 142761663 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine |
| SMILES | CC(C)(C)C#C/C=C/CC(C)(N)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H25N/c1-20(2,3)15-8-5-9-16-21(4,22)19-14-10-12-17-11-6-7-13-18(17)19/h5-7,9-14H,16,22H2,1-4H3/b9-5+ |
| InChIKey | CZOQXWKWQVERJU-WEVVVXLNSA-N |
| XLogP | 5.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine?
The IUPAC name of (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine (CID 142761663) is (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine.
What is the SMILES notation for (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine?
The canonical SMILES for (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine is CC(C)(C)C#C/C=C/CC(C)(N)c1cccc2ccccc12.
What is the InChIKey of (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine?
The InChIKey is CZOQXWKWQVERJU-WEVVVXLNSA-N. The full InChI is InChI=1S/C21H25N/c1-20(2,3)15-8-5-9-16-21(4,22)19-14-10-12-17-11-6-7-13-18(17)19/h5-7,9-14H,16,22H2,1-4H3/b9-5+.
What are the key properties of (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine?
(E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine has a molecular weight of 291.44 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine is sourced from PubChem (CID 142761663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).