C21H25N — CID 142761663
(E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine (PubChem CID 142761663) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine.
| Compound Name | (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine |
|---|---|
| PubChem CID | 142761663 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (E)-8,8-dimethyl-2-naphthalen-1-ylnon-4-en-6-yn-2-amine |
| SMILES | CC(C)(C)C#C/C=C/CC(C)(N)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H25N/c1-20(2,3)15-8-5-9-16-21(4,22)19-14-10-12-17-11-6-7-13-18(17)19/h5-7,9-14H,16,22H2,1-4H3/b9-5+ |
| InChIKey | CZOQXWKWQVERJU-WEVVVXLNSA-N |
| XLogP | 5.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|