C17H16N8O2 — CID 142762247
2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-(4-nitrophenyl)purin-8-amine (PubChem CID 142762247) has the molecular formula C17H16N8O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-(4-nitrophenyl)purin-8-amine.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-(4-nitrophenyl)purin-8-amine |
|---|---|
| PubChem CID | 142762247 |
| Molecular Formula | C17H16N8O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-(4-nitrophenyl)purin-8-amine |
| SMILES | Cc1cc(C)n(-c2ncc3nc(Nc4ccc([N+](=O)[O-])cc4)n(C)c3n2)n1 |
| InChI | InChI=1S/C17H16N8O2/c1-10-8-11(2)24(22-10)16-18-9-14-15(21-16)23(3)17(20-14)19-12-4-6-13(7-5-12)25(26)27/h4-9H,1-3H3,(H,19,20) |
| InChIKey | IQQJHEWJDUYJCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|