C45H34Cl2F2N6O3 — CID 142763294
2,2-bis[7-chloro-2-(5-fluoro-2-methylphenoxy)-1-phenylpyrrolo[2,3-c]pyridin-3-yl]piperazine-1-carbaldehyde (PubChem CID 142763294) has the molecular formula C45H34Cl2F2N6O3 and a molecular weight of 815.71 g/mol. Its IUPAC name is 2,2-bis[7-chloro-2-(5-fluoro-2-methylphenoxy)-1-phenylpyrrolo[2,3-c]pyridin-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 2,2-bis[7-chloro-2-(5-fluoro-2-methylphenoxy)-1-phenylpyrrolo[2,3-c]pyridin-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 142763294 |
| Molecular Formula | C45H34Cl2F2N6O3 |
| Molecular Weight | 815.71 g/mol |
| Exact Mass | 814.20 |
| IUPAC Name | 2,2-bis[7-chloro-2-(5-fluoro-2-methylphenoxy)-1-phenylpyrrolo[2,3-c]pyridin-3-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1ccc(F)cc1Oc1c(C2(c3c(Oc4cc(F)ccc4C)n(-c4ccccc4)c4c(Cl)nccc34)CNCCN2C=O)c2ccnc(Cl)c2n1-c1ccccc1 |
| InChI | InChI=1S/C45H34Cl2F2N6O3/c1-27-13-15-29(48)23-35(27)57-43-37(33-17-19-51-41(46)39(33)54(43)31-9-5-3-6-10-31)45(25-50-21-22-53(45)26-56)38-34-18-20-52-42(47)40(34)55(32-11-7-4-8-12-32)44(38)58-36-24-30(49)16-14-28(36)2/h3-20,23-24,26,50H,21-22,25H2,1-2H3 |
| InChIKey | YPSKZXYLTORINK-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.71 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|