C14H15NO — CID 142763611
2-(4-methoxypenta-1,4-dienyl)-1H-indole (PubChem CID 142763611) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(4-methoxypenta-1,4-dienyl)-1H-indole.
| Compound Name | 2-(4-methoxypenta-1,4-dienyl)-1H-indole |
|---|---|
| PubChem CID | 142763611 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-(4-methoxypenta-1,4-dienyl)-1H-indole |
| SMILES | C=C(CC=Cc1cc2ccccc2[nH]1)OC |
| InChI | InChI=1S/C14H15NO/c1-11(16-2)6-5-8-13-10-12-7-3-4-9-14(12)15-13/h3-5,7-10,15H,1,6H2,2H3 |
| InChIKey | UTLPASYUMOZKCG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|