About 8-but-2-enoxy-2,7-dimethylocta-1,6-diene
8-but-2-enoxy-2,7-dimethylocta-1,6-diene (PubChem CID 142763698) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 8-but-2-enoxy-2,7-dimethylocta-1,6-diene.
Molecular Properties
| Compound Name | 8-but-2-enoxy-2,7-dimethylocta-1,6-diene |
| PubChem CID | 142763698 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 8-but-2-enoxy-2,7-dimethylocta-1,6-diene |
| SMILES | C=C(C)CCCC=C(C)COCC=CC |
| InChI | InChI=1S/C14H24O/c1-5-6-11-15-12-14(4)10-8-7-9-13(2)3/h5-6,10H,2,7-9,11-12H2,1,3-4H3 |
| InChIKey | HXFBRFZAFAYPNK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-but-2-enoxy-2,7-dimethylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-2-enoxy-2,7-dimethylocta-1,6-diene?
The IUPAC name of 8-but-2-enoxy-2,7-dimethylocta-1,6-diene (CID 142763698) is 8-but-2-enoxy-2,7-dimethylocta-1,6-diene.
What is the SMILES notation for 8-but-2-enoxy-2,7-dimethylocta-1,6-diene?
The canonical SMILES for 8-but-2-enoxy-2,7-dimethylocta-1,6-diene is C=C(C)CCCC=C(C)COCC=CC.
What is the InChIKey of 8-but-2-enoxy-2,7-dimethylocta-1,6-diene?
The InChIKey is HXFBRFZAFAYPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-5-6-11-15-12-14(4)10-8-7-9-13(2)3/h5-6,10H,2,7-9,11-12H2,1,3-4H3.
What are the key properties of 8-but-2-enoxy-2,7-dimethylocta-1,6-diene?
8-but-2-enoxy-2,7-dimethylocta-1,6-diene has a molecular weight of 208.34 g/mol, XLogP of 4.27, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-2-enoxy-2,7-dimethylocta-1,6-diene is sourced from PubChem (CID 142763698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).