C14H8Cl2F4O2S2 — CID 142763748
2,3-bis(2-chloroethylsulfanyl)-5,6,7,8-tetrafluoronaphthalene-1,4-dione (PubChem CID 142763748) has the molecular formula C14H8Cl2F4O2S2 and a molecular weight of 419.25 g/mol. Its IUPAC name is 2,3-bis(2-chloroethylsulfanyl)-5,6,7,8-tetrafluoronaphthalene-1,4-dione.
| Compound Name | 2,3-bis(2-chloroethylsulfanyl)-5,6,7,8-tetrafluoronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142763748 |
| Molecular Formula | C14H8Cl2F4O2S2 |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 417.93 |
| IUPAC Name | 2,3-bis(2-chloroethylsulfanyl)-5,6,7,8-tetrafluoronaphthalene-1,4-dione |
| SMILES | O=C1C(SCCCl)=C(SCCCl)C(=O)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C14H8Cl2F4O2S2/c15-1-3-23-13-11(21)5-6(12(22)14(13)24-4-2-16)8(18)10(20)9(19)7(5)17/h1-4H2 |
| InChIKey | QBRRMFYCTPRXJU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|