C31H30F4OS — CID 142763896
2-[1,1,2,2-tetrafluoro-3-[4-(4-hexoxyphenyl)phenyl]propyl]sulfanylnaphthalene (PubChem CID 142763896) has the molecular formula C31H30F4OS and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[1,1,2,2-tetrafluoro-3-[4-(4-hexoxyphenyl)phenyl]propyl]sulfanylnaphthalene.
| Compound Name | 2-[1,1,2,2-tetrafluoro-3-[4-(4-hexoxyphenyl)phenyl]propyl]sulfanylnaphthalene |
|---|---|
| PubChem CID | 142763896 |
| Molecular Formula | C31H30F4OS |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-[1,1,2,2-tetrafluoro-3-[4-(4-hexoxyphenyl)phenyl]propyl]sulfanylnaphthalene |
| SMILES | CCCCCCOc1ccc(-c2ccc(CC(F)(F)C(F)(F)Sc3ccc4ccccc4c3)cc2)cc1 |
| InChI | InChI=1S/C31H30F4OS/c1-2-3-4-7-20-36-28-17-14-26(15-18-28)25-12-10-23(11-13-25)22-30(32,33)31(34,35)37-29-19-16-24-8-5-6-9-27(24)21-29/h5-6,8-19,21H,2-4,7,20,22H2,1H3 |
| InChIKey | JIWLVDIKIRDSRK-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|