C48H40N2O5S2 — CID 142764171
6-methoxy-2-[4-[(E)-2-[4-[2-[2-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]-1,3-benzothiazole (PubChem CID 142764171) has the molecular formula C48H40N2O5S2 and a molecular weight of 788.99 g/mol. Its IUPAC name is 6-methoxy-2-[4-[(E)-2-[4-[2-[2-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-[4-[(E)-2-[4-[2-[2-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 142764171 |
| Molecular Formula | C48H40N2O5S2 |
| Molecular Weight | 788.99 g/mol |
| Exact Mass | 788.24 |
| IUPAC Name | 6-methoxy-2-[4-[(E)-2-[4-[2-[2-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]-1,3-benzothiazole |
| SMILES | COc1ccc2nc(-c3ccc(/C=C/c4ccc(OCCOCCOc5ccc(/C=C/c6ccc(-c7nc8ccc(OC)cc8s7)cc6)cc5)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C48H40N2O5S2/c1-51-41-23-25-43-45(31-41)56-47(49-43)37-15-7-33(8-16-37)3-5-35-11-19-39(20-12-35)54-29-27-53-28-30-55-40-21-13-36(14-22-40)6-4-34-9-17-38(18-10-34)48-50-44-26-24-42(52-2)32-46(44)57-48/h3-26,31-32H,27-30H2,1-2H3/b5-3+,6-4+ |
| InChIKey | TVRQLUDICMFHSJ-GGWOSOGESA-N |
| XLogP | 12.07 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.99 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|