C14H25F3O3Si — CID 142764539
4-[tert-butyl(dimethyl)silyl]oxy-1-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 142764539) has the molecular formula C14H25F3O3Si and a molecular weight of 326.43 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142764539 |
| Molecular Formula | C14H25F3O3Si |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(C(=O)O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3O3Si/c1-12(2,3)21(4,5)20-10-6-8-13(9-7-10,11(18)19)14(15,16)17/h10H,6-9H2,1-5H3,(H,18,19) |
| InChIKey | XFAISZXRHWDKMO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|