C25H27NO5S — CID 142764559
[7-[2-(2,3-dimethoxyphenyl)ethoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-thiophen-2-ylmethanone (PubChem CID 142764559) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is [7-[2-(2,3-dimethoxyphenyl)ethoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-thiophen-2-ylmethanone.
| Compound Name | [7-[2-(2,3-dimethoxyphenyl)ethoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 142764559 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | [7-[2-(2,3-dimethoxyphenyl)ethoxymethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-thiophen-2-ylmethanone |
| SMILES | COc1cccc(CCOCc2ccc3c(c2)CN(C(=O)c2cccs2)CCO3)c1OC |
| InChI | InChI=1S/C25H27NO5S/c1-28-22-6-3-5-19(24(22)29-2)10-12-30-17-18-8-9-21-20(15-18)16-26(11-13-31-21)25(27)23-7-4-14-32-23/h3-9,14-15H,10-13,16-17H2,1-2H3 |
| InChIKey | PPPKRSMYMYKREL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|