About (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride
(2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride (PubChem CID 142764625) has the molecular formula C12H26ClN3O2
and a molecular weight of 279.81 g/mol. Its IUPAC name is (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride |
| PubChem CID | 142764625 |
| Molecular Formula | C12H26ClN3O2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride |
| SMILES | CCN1CCN([C@](C)(C(=O)O)C(C)(C)N)CC1.Cl |
| InChI | InChI=1S/C12H25N3O2.ClH/c1-5-14-6-8-15(9-7-14)12(4,10(16)17)11(2,3)13;/h5-9,13H2,1-4H3,(H,16,17);1H/t12-;/m1./s1 |
| InChIKey | YMFCHZGGWZCPFU-UTONKHPSSA-N |
| XLogP | 0.63 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride?
The IUPAC name of (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride (CID 142764625) is (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride.
What is the SMILES notation for (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride?
The canonical SMILES for (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride is CCN1CCN([C@](C)(C(=O)O)C(C)(C)N)CC1.Cl.
What is the InChIKey of (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride?
The InChIKey is YMFCHZGGWZCPFU-UTONKHPSSA-N. The full InChI is InChI=1S/C12H25N3O2.ClH/c1-5-14-6-8-15(9-7-14)12(4,10(16)17)11(2,3)13;/h5-9,13H2,1-4H3,(H,16,17);1H/t12-;/m1./s1.
What are the key properties of (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride?
(2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride has a molecular weight of 279.81 g/mol, XLogP of 0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-amino-2-(4-ethylpiperazin-1-yl)-2,3-dimethylbutanoic acid;hydrochloride is sourced from PubChem (CID 142764625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).