C16H22N2S2 — CID 142764923
trans-(1R,2R)-2-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 142764923) has the molecular formula C16H22N2S2 and a molecular weight of 306.50 g/mol. Its IUPAC name is trans-(1R,2R)-2-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 142764923 |
| Molecular Formula | C16H22N2S2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | trans-(1R,2R)-2-N,2-N-bis(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C16H22N2S2/c17-15-7-1-2-8-16(15)18(11-13-5-3-9-19-13)12-14-6-4-10-20-14/h3-6,9-10,15-16H,1-2,7-8,11-12,17H2/t15-,16-/m1/s1 |
| InChIKey | SRCPTKFEJOCDMQ-HZPDHXFCSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |