About Arg-Gly
Arg-Gly (PubChem CID 142765) has the molecular formula C8H17N5O3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
Molecular Properties
| Compound Name | Arg-Gly |
| PubChem CID | 142765 |
| Molecular Formula | C8H17N5O3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | C(C[C@@H](C(=O)NCC(=O)O)N)CN=C(N)N |
| InChI | InChI=1S/C8H17N5O3/c9-5(2-1-3-12-8(10)11)7(16)13-4-6(14)15/h5H,1-4,9H2,(H,13,16)(H,14,15)(H4,10,11,12)/t5-/m0/s1 |
| InChIKey | XUUXCWCKKCZEAW-YFKPBYRVSA-N |
| XLogP | -4.90 |
| TPSA | 157.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 275 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze Arg-Gly with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Arg-Gly?
The IUPAC name of Arg-Gly (CID 142765) is 2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
What is the SMILES notation for Arg-Gly?
The canonical SMILES for Arg-Gly is C(C[C@@H](C(=O)NCC(=O)O)N)CN=C(N)N.
What is the InChIKey of Arg-Gly?
The InChIKey is XUUXCWCKKCZEAW-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H17N5O3/c9-5(2-1-3-12-8(10)11)7(16)13-4-6(14)15/h5H,1-4,9H2,(H,13,16)(H,14,15)(H4,10,11,12)/t5-/m0/s1.
What are the key properties of Arg-Gly?
Arg-Gly has a molecular weight of 231.25 g/mol, XLogP of -4.90, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Arg-Gly is sourced from PubChem (CID 142765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).