C8H12BF3O2 — CID 142765273
4,4-dimethyl-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 142765273) has the molecular formula C8H12BF3O2 and a molecular weight of 207.99 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4-dimethyl-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142765273 |
| Molecular Formula | C8H12BF3O2 |
| Molecular Weight | 207.99 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4,4-dimethyl-2-[(E)-1,1,1-trifluorobut-2-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | C/C=C(\B1OCC(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C8H12BF3O2/c1-4-6(8(10,11)12)9-13-5-7(2,3)14-9/h4H,5H2,1-3H3/b6-4- |
| InChIKey | SLMJRMHZGPNCSS-XQRVVYSFSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.99 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|