C23H26N4O6S — CID 142765322
2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-N-methylsulfonylbenzohydrazide (PubChem CID 142765322) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-N-methylsulfonylbenzohydrazide.
| Compound Name | 2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-N-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 142765322 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[3-tert-butyl-5-(2,4-dioxopyrimidin-1-yl)-2-methoxyphenyl]-N-methylsulfonylbenzohydrazide |
| SMILES | COc1c(-c2ccccc2C(=O)N(N)S(C)(=O)=O)cc(-n2ccc(=O)[nH]c2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C23H26N4O6S/c1-23(2,3)18-13-14(26-11-10-19(28)25-22(26)30)12-17(20(18)33-4)15-8-6-7-9-16(15)21(29)27(24)34(5,31)32/h6-13H,24H2,1-5H3,(H,25,28,30) |
| InChIKey | RUHGHIUDIZYRAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|