C12H2F8O7S2 — CID 142765455
2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfophenoxy)benzenesulfonic acid (PubChem CID 142765455) has the molecular formula C12H2F8O7S2 and a molecular weight of 474.26 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfophenoxy)benzenesulfonic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfophenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 142765455 |
| Molecular Formula | C12H2F8O7S2 |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5-tetrafluoro-6-sulfophenoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1Oc1c(F)c(F)c(F)c(F)c1S(=O)(=O)O |
| InChI | InChI=1S/C12H2F8O7S2/c13-1-3(15)7(19)11(28(21,22)23)9(5(1)17)27-10-6(18)2(14)4(16)8(20)12(10)29(24,25)26/h(H,21,22,23)(H,24,25,26) |
| InChIKey | UGJQWOLCALTFID-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|