About 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde
3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde (PubChem CID 142766285) has the molecular formula C14H6F4O3
and a molecular weight of 298.19 g/mol. Its IUPAC name is 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde |
| PubChem CID | 142766285 |
| Molecular Formula | C14H6F4O3 |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde |
| SMILES | O=Cc1c(F)ccc(Oc2ccc(F)c(C=O)c2F)c1F |
| InChI | InChI=1S/C14H6F4O3/c15-9-1-3-11(13(17)7(9)5-19)21-12-4-2-10(16)8(6-20)14(12)18/h1-6H |
| InChIKey | XLQWTOARCKYAFB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde?
The IUPAC name of 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde (CID 142766285) is 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde.
What is the SMILES notation for 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde?
The canonical SMILES for 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde is O=Cc1c(F)ccc(Oc2ccc(F)c(C=O)c2F)c1F.
What is the InChIKey of 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde?
The InChIKey is XLQWTOARCKYAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6F4O3/c15-9-1-3-11(13(17)7(9)5-19)21-12-4-2-10(16)8(6-20)14(12)18/h1-6H.
What are the key properties of 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde?
3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde has a molecular weight of 298.19 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluoro-3-formylphenoxy)-2,6-difluorobenzaldehyde is sourced from PubChem (CID 142766285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).