C18H23NO11 — CID 142766759
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,5-dioxopyrrolidin-1-yl)oxan-2-yl]methyl acetate (PubChem CID 142766759) has the molecular formula C18H23NO11 and a molecular weight of 429.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,5-dioxopyrrolidin-1-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,5-dioxopyrrolidin-1-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142766759 |
| Molecular Formula | C18H23NO11 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2,5-dioxopyrrolidin-1-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)CCC2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H23NO11/c1-8(20)26-7-12-15(27-9(2)21)16(28-10(3)22)17(29-11(4)23)18(30-12)19-13(24)5-6-14(19)25/h12,15-18H,5-7H2,1-4H3/t12-,15-,16+,17-,18-/m1/s1 |
| InChIKey | IBJPOSLZLUAGSC-SOGIYBJLSA-N |
| XLogP | -0.78 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|