C54H57F9N9O7P — CID 142767090
tris[1-[4-[6-(1-aminoethyl)-3-pyridinyl]phenyl]-2-[(2,2-difluoroacetyl)amino]-3-fluoropropyl] phosphate (PubChem CID 142767090) has the molecular formula C54H57F9N9O7P and a molecular weight of 1146.06 g/mol. Its IUPAC name is tris[1-[4-[6-(1-aminoethyl)-3-pyridinyl]phenyl]-2-[(2,2-difluoroacetyl)amino]-3-fluoropropyl] phosphate.
| Compound Name | tris[1-[4-[6-(1-aminoethyl)-3-pyridinyl]phenyl]-2-[(2,2-difluoroacetyl)amino]-3-fluoropropyl] phosphate |
|---|---|
| PubChem CID | 142767090 |
| Molecular Formula | C54H57F9N9O7P |
| Molecular Weight | 1146.06 g/mol |
| Exact Mass | 1145.40 |
| IUPAC Name | tris[1-[4-[6-(1-aminoethyl)-3-pyridinyl]phenyl]-2-[(2,2-difluoroacetyl)amino]-3-fluoropropyl] phosphate |
| SMILES | CC(N)c1ccc(-c2ccc(C(OP(=O)(OC(c3ccc(-c4ccc(C(C)N)nc4)cc3)C(CF)NC(=O)C(F)F)OC(c3ccc(-c4ccc(C(C)N)nc4)cc3)C(CF)NC(=O)C(F)F)C(CF)NC(=O)C(F)F)cc2)cn1 |
| InChI | InChI=1S/C54H57F9N9O7P/c1-28(64)40-19-16-37(25-67-40)31-4-10-34(11-5-31)46(43(22-55)70-52(73)49(58)59)77-80(76,78-47(44(23-56)71-53(74)50(60)61)35-12-6-32(7-13-35)38-17-20-41(29(2)65)68-26-38)79-48(45(24-57)72-54(75)51(62)63)36-14-8-33(9-15-36)39-18-21-42(30(3)66)69-27-39/h4-21,25-30,43-51H,22-24,64-66H2,1-3H3,(H,70,73)(H,71,74)(H,72,75) |
| InChIKey | AMIRIWALYRZYNQ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 248.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 80 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.06 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|