C31H42N8O3S — CID 142767299
4,11-bis(5-aminopentylamino)-N-[3-(diaminomethylideneamino)propyl]-5,10-dioxonaphtho[2,3-f][1]benzothiole-2-carboxamide (PubChem CID 142767299) has the molecular formula C31H42N8O3S and a molecular weight of 606.80 g/mol. Its IUPAC name is 4,11-bis(5-aminopentylamino)-N-[3-(diaminomethylideneamino)propyl]-5,10-dioxonaphtho[2,3-f][1]benzothiole-2-carboxamide.
| Compound Name | 4,11-bis(5-aminopentylamino)-N-[3-(diaminomethylideneamino)propyl]-5,10-dioxonaphtho[2,3-f][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 142767299 |
| Molecular Formula | C31H42N8O3S |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | 4,11-bis(5-aminopentylamino)-N-[3-(diaminomethylideneamino)propyl]-5,10-dioxonaphtho[2,3-f][1]benzothiole-2-carboxamide |
| SMILES | NCCCCCNc1c2c(c(NCCCCCN)c3sc(C(=O)NCCCN=C(N)N)cc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H42N8O3S/c32-12-5-1-7-14-36-25-21-18-22(30(42)38-16-9-17-39-31(34)35)43-29(21)26(37-15-8-2-6-13-33)24-23(25)27(40)19-10-3-4-11-20(19)28(24)41/h3-4,10-11,18,36-37H,1-2,5-9,12-17,32-33H2,(H,38,42)(H4,34,35,39) |
| InChIKey | JUUMYWYXVRXHLC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 203.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|