C16H23ClF10N2O — CID 142768060
1-[(2S)-2-[(2S)-3-(4,4-difluoropiperidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]-4,4-difluoropiperidine;hydrochloride (PubChem CID 142768060) has the molecular formula C16H23ClF10N2O and a molecular weight of 484.81 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S)-3-(4,4-difluoropiperidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]-4,4-difluoropiperidine;hydrochloride.
| Compound Name | 1-[(2S)-2-[(2S)-3-(4,4-difluoropiperidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]-4,4-difluoropiperidine;hydrochloride |
|---|---|
| PubChem CID | 142768060 |
| Molecular Formula | C16H23ClF10N2O |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[(2S)-2-[(2S)-3-(4,4-difluoropiperidin-1-yl)-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]-4,4-difluoropiperidine;hydrochloride |
| SMILES | Cl.FC1(F)CCN(C[C@H](O[C@@H](CN2CCC(F)(F)CC2)C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F10N2O.ClH/c17-13(18)1-5-27(6-2-13)9-11(15(21,22)23)29-12(16(24,25)26)10-28-7-3-14(19,20)4-8-28;/h11-12H,1-10H2;1H/t11-,12-;/m0./s1 |
| InChIKey | SPYMTJCDYJPEON-FXMYHANSSA-N |
| XLogP | 4.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |