C22H20F2N4O5 — CID 142768209
(2S)-3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(2,5-difluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoic acid (PubChem CID 142768209) has the molecular formula C22H20F2N4O5 and a molecular weight of 458.42 g/mol. Its IUPAC name is (2S)-3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(2,5-difluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(2,5-difluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142768209 |
| Molecular Formula | C22H20F2N4O5 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2S)-3-[[(3-acetyl-1H-pyrazole-5-carbonyl)amino]-[[4-(2,5-difluorophenyl)phenyl]methyl]amino]-2-hydroxypropanoic acid |
| SMILES | CC(=O)c1cc(C(=O)NN(Cc2ccc(-c3cc(F)ccc3F)cc2)C[C@H](O)C(=O)O)[nH]n1 |
| InChI | InChI=1S/C22H20F2N4O5/c1-12(29)18-9-19(26-25-18)21(31)27-28(11-20(30)22(32)33)10-13-2-4-14(5-3-13)16-8-15(23)6-7-17(16)24/h2-9,20,30H,10-11H2,1H3,(H,25,26)(H,27,31)(H,32,33)/t20-/m0/s1 |
| InChIKey | POAYEOUSJSFTNG-FQEVSTJZSA-N |
| XLogP | 2.15 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|