C14H15NO — CID 142768688
2-cyclobutyl-5-(4-methylphenyl)-1,3-oxazole (PubChem CID 142768688) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-cyclobutyl-5-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 2-cyclobutyl-5-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 142768688 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-cyclobutyl-5-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2cnc(C3CCC3)o2)cc1 |
| InChI | InChI=1S/C14H15NO/c1-10-5-7-11(8-6-10)13-9-15-14(16-13)12-3-2-4-12/h5-9,12H,2-4H2,1H3 |
| InChIKey | AFJNLVABDWDROS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |