C9H12O4S2 — CID 142768836
dimethyl 5,7-dihydro-1,4-dithiepine-6,6-dicarboxylate (PubChem CID 142768836) has the molecular formula C9H12O4S2 and a molecular weight of 248.32 g/mol. Its IUPAC name is dimethyl 5,7-dihydro-1,4-dithiepine-6,6-dicarboxylate.
| Compound Name | dimethyl 5,7-dihydro-1,4-dithiepine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 142768836 |
| Molecular Formula | C9H12O4S2 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | dimethyl 5,7-dihydro-1,4-dithiepine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CSC=CSC1 |
| InChI | InChI=1S/C9H12O4S2/c1-12-7(10)9(8(11)13-2)5-14-3-4-15-6-9/h3-4H,5-6H2,1-2H3 |
| InChIKey | OOCGCDHXIRPVBT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|