About [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate
[(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate (PubChem CID 142769646) has the molecular formula C17H21Cl2N5O2
and a molecular weight of 398.29 g/mol. Its IUPAC name is [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate |
| PubChem CID | 142769646 |
| Molecular Formula | C17H21Cl2N5O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)O[C@@H]1CCN(c2nc3ncc(Cl)cc3nc2Cl)C1)C(C)(C)C |
| InChI | InChI=1S/C17H21Cl2N5O2/c1-17(2,3)23(4)16(25)26-11-5-6-24(9-11)15-13(19)21-12-7-10(18)8-20-14(12)22-15/h7-8,11H,5-6,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | MODHJYYQDCAZNH-LLVKDONJSA-N |
| XLogP | 3.78 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate?
The IUPAC name of [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate (CID 142769646) is [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate.
What is the SMILES notation for [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate?
The canonical SMILES for [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate is CN(C(=O)O[C@@H]1CCN(c2nc3ncc(Cl)cc3nc2Cl)C1)C(C)(C)C.
What is the InChIKey of [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate?
The InChIKey is MODHJYYQDCAZNH-LLVKDONJSA-N. The full InChI is InChI=1S/C17H21Cl2N5O2/c1-17(2,3)23(4)16(25)26-11-5-6-24(9-11)15-13(19)21-12-7-10(18)8-20-14(12)22-15/h7-8,11H,5-6,9H2,1-4H3/t11-/m1/s1.
What are the key properties of [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate?
[(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate has a molecular weight of 398.29 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-(2,7-dichloropyrido[2,3-b]pyrazin-3-yl)pyrrolidin-3-yl] N-tert-butyl-N-methylcarbamate is sourced from PubChem (CID 142769646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).