C17H20N8O4 — CID 142769663
[1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate (PubChem CID 142769663) has the molecular formula C17H20N8O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is [1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate.
| Compound Name | [1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 142769663 |
| Molecular Formula | C17H20N8O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [1-(12-nitro-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)azetidin-3-yl] N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OC1CN(c2nc3ncc([N+](=O)[O-])cc3n3cnnc23)C1)C(C)(C)C |
| InChI | InChI=1S/C17H20N8O4/c1-17(2,3)22(4)16(26)29-11-7-23(8-11)14-15-21-19-9-24(15)12-5-10(25(27)28)6-18-13(12)20-14/h5-6,9,11H,7-8H2,1-4H3 |
| InChIKey | QUZVEUCAKOQJEM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 131.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|