About 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one
5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one (PubChem CID 142769918) has the molecular formula C19H17ClO4S
and a molecular weight of 376.86 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one |
| PubChem CID | 142769918 |
| Molecular Formula | C19H17ClO4S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one |
| SMILES | CC1(C)OC(c2cccc(Cl)c2)=C(c2ccc(S(C)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C19H17ClO4S/c1-19(2)18(21)16(12-7-9-15(10-8-12)25(3,22)23)17(24-19)13-5-4-6-14(20)11-13/h4-11H,1-3H3 |
| InChIKey | NIYMJTMJHCMFSJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one?
The IUPAC name of 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one (CID 142769918) is 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one.
What is the SMILES notation for 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one?
The canonical SMILES for 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one is CC1(C)OC(c2cccc(Cl)c2)=C(c2ccc(S(C)(=O)=O)cc2)C1=O.
What is the InChIKey of 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one?
The InChIKey is NIYMJTMJHCMFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClO4S/c1-19(2)18(21)16(12-7-9-15(10-8-12)25(3,22)23)17(24-19)13-5-4-6-14(20)11-13/h4-11H,1-3H3.
What are the key properties of 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one?
5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one has a molecular weight of 376.86 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-2,2-dimethyl-4-(4-methylsulfonylphenyl)furan-3-one is sourced from PubChem (CID 142769918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).