C12H11BrFN3O4 — CID 14277011
2-[4-bromo-2-fluoro-5-(methoxymethoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 14277011) has the molecular formula C12H11BrFN3O4 and a molecular weight of 360.14 g/mol. Its IUPAC name is 2-[4-bromo-2-fluoro-5-(methoxymethoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-bromo-2-fluoro-5-(methoxymethoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 14277011 |
| Molecular Formula | C12H11BrFN3O4 |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2-[4-bromo-2-fluoro-5-(methoxymethoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | COCOc1cc(-n2ncc(=O)n(C)c2=O)c(F)cc1Br |
| InChI | InChI=1S/C12H11BrFN3O4/c1-16-11(18)5-15-17(12(16)19)9-4-10(21-6-20-2)7(13)3-8(9)14/h3-5H,6H2,1-2H3 |
| InChIKey | IDTROVKOJOBEBA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|