(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid

C6H7BFNO3 — CID 142770118

IUPAC(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid
SMILESCc1cc(OB(O)O)cnc1F
InChIInChI=1S/C6H7BFNO3/c1-4-2-5(12-7(10)11)3-9-6(4)8/h2-3,10-11H,1H3
InChIKeyCPEGETCNADURJI-UHFFFAOYSA-N
MW170.94 g/mol
LogP-0.12
Rot. Bonds2

About (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid

(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid (PubChem CID 142770118) has the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. Its IUPAC name is (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid.

Molecular Properties

Compound Name(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid
PubChem CID142770118
Molecular FormulaC6H7BFNO3
Molecular Weight170.94 g/mol
Exact Mass171.05
IUPAC Name(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid
SMILESCc1cc(OB(O)O)cnc1F
InChIInChI=1S/C6H7BFNO3/c1-4-2-5(12-7(10)11)3-9-6(4)8/h2-3,10-11H,1H3
InChIKeyCPEGETCNADURJI-UHFFFAOYSA-N
XLogP-0.12
TPSA62.58 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.94
LogP ≤ 5-0.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid?
The IUPAC name of (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid (CID 142770118) is (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid.
What is the SMILES notation for (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid?
The canonical SMILES for (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid is Cc1cc(OB(O)O)cnc1F.
What is the InChIKey of (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid?
The InChIKey is CPEGETCNADURJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BFNO3/c1-4-2-5(12-7(10)11)3-9-6(4)8/h2-3,10-11H,1H3.
What are the key properties of (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid?
(6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid has a molecular weight of 170.94 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-5-methyl-3-pyridinyl)oxyboronic acid is sourced from PubChem (CID 142770118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).