C34H45N3O3 — CID 142771608
(Z)-18-(2-anilino-6-oxo-1-phenylpyrimidin-4-yl)octadec-9-enoic acid (PubChem CID 142771608) has the molecular formula C34H45N3O3 and a molecular weight of 543.75 g/mol. Its IUPAC name is (Z)-18-(2-anilino-6-oxo-1-phenylpyrimidin-4-yl)octadec-9-enoic acid.
| Compound Name | (Z)-18-(2-anilino-6-oxo-1-phenylpyrimidin-4-yl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 142771608 |
| Molecular Formula | C34H45N3O3 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | (Z)-18-(2-anilino-6-oxo-1-phenylpyrimidin-4-yl)octadec-9-enoic acid |
| SMILES | O=C(O)CCCCCCC/C=C\CCCCCCCCc1cc(=O)n(-c2ccccc2)c(Nc2ccccc2)n1 |
| InChI | InChI=1S/C34H45N3O3/c38-32-28-30(36-34(35-29-22-17-14-18-23-29)37(32)31-25-19-15-20-26-31)24-16-12-10-8-6-4-2-1-3-5-7-9-11-13-21-27-33(39)40/h1,3,14-15,17-20,22-23,25-26,28H,2,4-13,16,21,24,27H2,(H,35,36)(H,39,40)/b3-1- |
| InChIKey | YTRVWCXFIOZLLN-IWQZZHSRSA-N |
| XLogP | 8.62 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|