C21H24BNO7 — CID 142771872
[(1S)-2-(1-benzofuran-3-yl)-1-[[2-[2-(3-hydroxypropoxy)phenyl]acetyl]amino]ethoxy]boronic acid (PubChem CID 142771872) has the molecular formula C21H24BNO7 and a molecular weight of 413.24 g/mol. Its IUPAC name is [(1S)-2-(1-benzofuran-3-yl)-1-[[2-[2-(3-hydroxypropoxy)phenyl]acetyl]amino]ethoxy]boronic acid.
| Compound Name | [(1S)-2-(1-benzofuran-3-yl)-1-[[2-[2-(3-hydroxypropoxy)phenyl]acetyl]amino]ethoxy]boronic acid |
|---|---|
| PubChem CID | 142771872 |
| Molecular Formula | C21H24BNO7 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(1S)-2-(1-benzofuran-3-yl)-1-[[2-[2-(3-hydroxypropoxy)phenyl]acetyl]amino]ethoxy]boronic acid |
| SMILES | O=C(Cc1ccccc1OCCCO)N[C@H](Cc1coc2ccccc12)OB(O)O |
| InChI | InChI=1S/C21H24BNO7/c24-10-5-11-28-18-8-3-1-6-15(18)12-20(25)23-21(30-22(26)27)13-16-14-29-19-9-4-2-7-17(16)19/h1-4,6-9,14,21,24,26-27H,5,10-13H2,(H,23,25)/t21-/m0/s1 |
| InChIKey | MXBAEOIODHUPRB-NRFANRHFSA-N |
| XLogP | 1.41 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|