C14H18F3N3O — CID 142772597
3-methyl-5-[6,6,6-trifluoro-5-(4-methylpyrazol-1-yl)hexyl]-1,2-oxazole (PubChem CID 142772597) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 3-methyl-5-[6,6,6-trifluoro-5-(4-methylpyrazol-1-yl)hexyl]-1,2-oxazole.
| Compound Name | 3-methyl-5-[6,6,6-trifluoro-5-(4-methylpyrazol-1-yl)hexyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142772597 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-methyl-5-[6,6,6-trifluoro-5-(4-methylpyrazol-1-yl)hexyl]-1,2-oxazole |
| SMILES | Cc1cnn(C(CCCCc2cc(C)no2)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3N3O/c1-10-8-18-20(9-10)13(14(15,16)17)6-4-3-5-12-7-11(2)19-21-12/h7-9,13H,3-6H2,1-2H3 |
| InChIKey | FCXWZFGVPRQVOE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|