About (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol
(5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol (PubChem CID 142772901) has the molecular formula C8H4Br2N4O5
and a molecular weight of 395.95 g/mol. Its IUPAC name is (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol.
Molecular Properties
| Compound Name | (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol |
| PubChem CID | 142772901 |
| Molecular Formula | C8H4Br2N4O5 |
| Molecular Weight | 395.95 g/mol |
| Exact Mass | 393.85 |
| IUPAC Name | (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol |
| SMILES | O=[N+]([O-])c1c(Br)c([N+](=O)[O-])c2nc(CO)[nH]c2c1Br |
| InChI | InChI=1S/C8H4Br2N4O5/c9-3-5-6(12-2(1-15)11-5)8(14(18)19)4(10)7(3)13(16)17/h15H,1H2,(H,11,12) |
| InChIKey | BHGSWLUAJAHHNW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.95 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol?
The IUPAC name of (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol (CID 142772901) is (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol.
What is the SMILES notation for (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol?
The canonical SMILES for (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol is O=[N+]([O-])c1c(Br)c([N+](=O)[O-])c2nc(CO)[nH]c2c1Br.
What is the InChIKey of (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol?
The InChIKey is BHGSWLUAJAHHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2N4O5/c9-3-5-6(12-2(1-15)11-5)8(14(18)19)4(10)7(3)13(16)17/h15H,1H2,(H,11,12).
What are the key properties of (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol?
(5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol has a molecular weight of 395.95 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dibromo-4,6-dinitro-1H-benzimidazol-2-yl)methanol is sourced from PubChem (CID 142772901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).