About 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid
3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid (PubChem CID 142773934) has the molecular formula C15H8F3N3O4S
and a molecular weight of 383.31 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 142773934 |
| Molecular Formula | C15H8F3N3O4S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid |
| SMILES | O=C(Nc1onc(-c2nccs2)c1C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8F3N3O4S/c16-15(17,18)8-3-1-7(2-4-8)11(22)20-12-9(14(23)24)10(21-25-12)13-19-5-6-26-13/h1-6H,(H,20,22)(H,23,24) |
| InChIKey | ARRBJILFHKHSJX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid (CID 142773934) is 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid is O=C(Nc1onc(-c2nccs2)c1C(=O)O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid?
The InChIKey is ARRBJILFHKHSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N3O4S/c16-15(17,18)8-3-1-7(2-4-8)11(22)20-12-9(14(23)24)10(21-25-12)13-19-5-6-26-13/h1-6H,(H,20,22)(H,23,24).
What are the key properties of 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid?
3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid has a molecular weight of 383.31 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yl)-5-[[4-(trifluoromethyl)benzoyl]amino]-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 142773934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).