About 5-ethyl-4-oxohept-2-ynal
5-ethyl-4-oxohept-2-ynal (PubChem CID 142774567) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 5-ethyl-4-oxohept-2-ynal.
Molecular Properties
| Compound Name | 5-ethyl-4-oxohept-2-ynal |
| PubChem CID | 142774567 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 5-ethyl-4-oxohept-2-ynal |
| SMILES | CCC(CC)C(=O)C#CC=O |
| InChI | InChI=1S/C9H12O2/c1-3-8(4-2)9(11)6-5-7-10/h7-8H,3-4H2,1-2H3 |
| InChIKey | NQWQCMIXGKLRTA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-oxohept-2-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-oxohept-2-ynal?
The IUPAC name of 5-ethyl-4-oxohept-2-ynal (CID 142774567) is 5-ethyl-4-oxohept-2-ynal.
What is the SMILES notation for 5-ethyl-4-oxohept-2-ynal?
The canonical SMILES for 5-ethyl-4-oxohept-2-ynal is CCC(CC)C(=O)C#CC=O.
What is the InChIKey of 5-ethyl-4-oxohept-2-ynal?
The InChIKey is NQWQCMIXGKLRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-3-8(4-2)9(11)6-5-7-10/h7-8H,3-4H2,1-2H3.
What are the key properties of 5-ethyl-4-oxohept-2-ynal?
5-ethyl-4-oxohept-2-ynal has a molecular weight of 152.19 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-oxohept-2-ynal is sourced from PubChem (CID 142774567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).