C13H23N3O2 — CID 142774582
[4-(1-azabicyclo[2.2.2]octan-3-yl)-1,4-diazepan-1-yl] formate (PubChem CID 142774582) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is [4-(1-azabicyclo[2.2.2]octan-3-yl)-1,4-diazepan-1-yl] formate.
| Compound Name | [4-(1-azabicyclo[2.2.2]octan-3-yl)-1,4-diazepan-1-yl] formate |
|---|---|
| PubChem CID | 142774582 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | [4-(1-azabicyclo[2.2.2]octan-3-yl)-1,4-diazepan-1-yl] formate |
| SMILES | O=CON1CCCN(C2CN3CCC2CC3)CC1 |
| InChI | InChI=1S/C13H23N3O2/c17-11-18-16-5-1-4-15(8-9-16)13-10-14-6-2-12(13)3-7-14/h11-13H,1-10H2 |
| InChIKey | MICQHZICAZONAM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|