C28H36F7NO4S — CID 142774659
[(5R)-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate (PubChem CID 142774659) has the molecular formula C28H36F7NO4S and a molecular weight of 615.65 g/mol. Its IUPAC name is [(5R)-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate.
| Compound Name | [(5R)-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate |
|---|---|
| PubChem CID | 142774659 |
| Molecular Formula | C28H36F7NO4S |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | [(5R)-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctyl] N-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamate |
| SMILES | C=C[C@@]12CCc3cc(NS(=O)(=O)OCCCC[C@@H](O)C(F)(F)C(F)(F)C(F)(F)F)ccc3[C@H]1CC[C@]1(C)CCC[C@H]12 |
| InChI | InChI=1S/C28H36F7NO4S/c1-3-25-15-11-18-17-19(9-10-20(18)21(25)12-14-24(2)13-6-7-22(24)25)36-41(38,39)40-16-5-4-8-23(37)26(29,30)27(31,32)28(33,34)35/h3,9-10,17,21-23,36-37H,1,4-8,11-16H2,2H3/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | ZVOWKEMXONLSFH-UUFXTFJOSA-N |
| XLogP | 7.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|