C18H26O2 — CID 142774848
(8S,9S,13S,14S,17R)-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 142774848) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (8S,9S,13S,14S,17R)-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,9S,13S,14S,17R)-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 142774848 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (8S,9S,13S,14S,17R)-3-methoxy-4,6,7,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COC1=CCC2=C(CC[C@H]3[C@@H]4CC[C@@H](O)[C@H]4CC[C@H]23)C1 |
| InChI | InChI=1S/C18H26O2/c1-20-12-3-5-13-11(10-12)2-4-15-14(13)6-7-17-16(15)8-9-18(17)19/h3,14-19H,2,4-10H2,1H3/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | QTSYTSHBAAYKBP-DFBDCSAJSA-N |
| XLogP | 3.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|