About 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide
2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide (PubChem CID 142775335) has the molecular formula C10H6FN3O3S
and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 142775335 |
| Molecular Formula | C10H6FN3O3S |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(-c2nccs2)c1F |
| InChI | InChI=1S/C10H6FN3O3S/c11-8-5(9(12)15)1-2-6(14(16)17)7(8)10-13-3-4-18-10/h1-4H,(H2,12,15) |
| InChIKey | TTZRBBLWBNZCIN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide (CID 142775335) is 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide is NC(=O)c1ccc([N+](=O)[O-])c(-c2nccs2)c1F.
What is the InChIKey of 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide?
The InChIKey is TTZRBBLWBNZCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6FN3O3S/c11-8-5(9(12)15)1-2-6(14(16)17)7(8)10-13-3-4-18-10/h1-4H,(H2,12,15).
What are the key properties of 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide?
2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide has a molecular weight of 267.24 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-nitro-3-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 142775335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).