C21H26Cl2F2N4O — CID 142775560
N-[(2,6-difluoro-4-pyridinyl)methyl]-1-methyl-2-piperazin-1-yl-1,3-dihydroindene-2-carboxamide;dihydrochloride (PubChem CID 142775560) has the molecular formula C21H26Cl2F2N4O and a molecular weight of 459.37 g/mol. Its IUPAC name is N-[(2,6-difluoro-4-pyridinyl)methyl]-1-methyl-2-piperazin-1-yl-1,3-dihydroindene-2-carboxamide;dihydrochloride.
| Compound Name | N-[(2,6-difluoro-4-pyridinyl)methyl]-1-methyl-2-piperazin-1-yl-1,3-dihydroindene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 142775560 |
| Molecular Formula | C21H26Cl2F2N4O |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[(2,6-difluoro-4-pyridinyl)methyl]-1-methyl-2-piperazin-1-yl-1,3-dihydroindene-2-carboxamide;dihydrochloride |
| SMILES | CC1c2ccccc2CC1(C(=O)NCc1cc(F)nc(F)c1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H24F2N4O.2ClH/c1-14-17-5-3-2-4-16(17)12-21(14,27-8-6-24-7-9-27)20(28)25-13-15-10-18(22)26-19(23)11-15;;/h2-5,10-11,14,24H,6-9,12-13H2,1H3,(H,25,28);2*1H |
| InChIKey | ZJFZTTPCMPTTOC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|