C20H18F3NO3S — CID 14277611
S-[4-(4-methoxyphenyl)-2-oxo-7-(trifluoromethyl)-1,3,4,5-tetrahydro-1-benzazepin-3-yl] ethanethioate (PubChem CID 14277611) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is S-[4-(4-methoxyphenyl)-2-oxo-7-(trifluoromethyl)-1,3,4,5-tetrahydro-1-benzazepin-3-yl] ethanethioate.
| Compound Name | S-[4-(4-methoxyphenyl)-2-oxo-7-(trifluoromethyl)-1,3,4,5-tetrahydro-1-benzazepin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 14277611 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | S-[4-(4-methoxyphenyl)-2-oxo-7-(trifluoromethyl)-1,3,4,5-tetrahydro-1-benzazepin-3-yl] ethanethioate |
| SMILES | COc1ccc(C2Cc3cc(C(F)(F)F)ccc3NC(=O)C2SC(C)=O)cc1 |
| InChI | InChI=1S/C20H18F3NO3S/c1-11(25)28-18-16(12-3-6-15(27-2)7-4-12)10-13-9-14(20(21,22)23)5-8-17(13)24-19(18)26/h3-9,16,18H,10H2,1-2H3,(H,24,26) |
| InChIKey | YDQNPCFLTHDHRB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|